Home
Products
Protosappanin B
| Product Name | Protosappanin B |
| Price: | $62 / 20mg |
| Catalog No.: | CN06609 |
| CAS No.: | 102036-29-3 |
| Molecular Formula: | C16H16O6 |
| Molecular Weight: | 304.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The heart wood of Caesalpinia sappan L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1(O)COc2cc(O)ccc2c2c(C1)cc(O)c(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Protosappanin B is a phenolic compound extracted from Lignum Sappan. Anti-cancer activity[1]. Protosappanin B induces apoptosis and causes G1 cell cycle arrest in human bladder cancer cells[2]. |
| Target | Apoptosis[2] |
| In Vitro | Protosappanin B (12.5, 25, 50, 100, 200 µg/mL, 48 hours) dose-dependently inhibits tumor cells, with IC50s of 21.32 µg/mL, 26.73 µg/mL, and 76.53 µg/mL for SW-480, HCT-116, and BTT cells, respectively[1]. Cell Viability Assay[1] Cell Line: CT-116, SW-480, and BTT Cells Concentration: 12.5, 25, 50, 100, 200 µg/mL Incubation Time: 48 hours Result: Dose-dependently inhibited tumor cells after 48 hours of treatment. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 655.5±55.0 °C at 760 mmHg |
| Flash Point | 350.2±31.5 °C |
| Exact Mass | 304.094696 |
| PSA | 110.38000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | 2~8℃ |