Home
Products
Mulberrofuran Q
| Product Name | Mulberrofuran Q |
| Price: | $467 / 5mg |
| Catalog No.: | CN03427 |
| CAS No.: | 101383-35-1 |
| Molecular Formula: | C34H24O10 |
| Molecular Weight: | 592.55 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(c(c1)O)C12Oc3cc(cc(c3C3C2(O1)C1CC(C3=O)(C)Oc2c1ccc(c2)O)O)c1oc2c(c1)ccc(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mulberrofuran Q inhibits the formation of 12-hydroxy-5,8,10-heptadecatrienoic acid (HHT) and thromboxane B2 (cyclooxygenase products)[1]. |
| Exact Mass | 592.13700 |
| PSA | 162.35000 |
| LogP | 5.63350 |