Home
Products
3'-O-Methylbatatasin III
| Product Name | 3'-O-Methylbatatasin III |
| Price: | $307 / 5mg |
| Catalog No.: | CN03394 |
| CAS No.: | 101330-69-2 |
| Molecular Formula: | C16H18O3 |
| Molecular Weight: | 258.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Dendrobium venustum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cccc(c1)CCc1cc(O)cc(c1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3'-O-Methylbatatasin III shows spasmolytic activity[1]. |
| Exact Mass | 258.12600 |
| PSA | 38.69000 |
| LogP | 3.19460 |