Home
Products
Noreugenin
| Product Name | Noreugenin |
| Price: | $204 / 10mg |
| Catalog No.: | CN05588 |
| CAS No.: | 1013-69-0 |
| Molecular Formula: | C10H8O4 |
| Molecular Weight: | 192.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rootbark of Schumanniophyton magnificum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(cc2=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Noreugenin, 5,7-dihydroxy-2-methyl-4H-chromen-4-one, is a new chromone from Hymenocallis littoralis Salisb. (Amaryllidaceae)[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 394.6±42.0 °C at 760 mmHg |
| Flash Point | 164.0±21.4 °C |
| Exact Mass | 192.042252 |
| PSA | 70.67000 |
| LogP | 1.58 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |