Home
Products
(R)-5-Hydroxy-1,7-diphenyl-3-heptanone
| Product Name | (R)-5-Hydroxy-1,7-diphenyl-3-heptanone |
| Price: | $599 / 5mg |
| Catalog No.: | CN03837 |
| CAS No.: | 100761-20-4 |
| Molecular Formula: | C19H22O2 |
| Molecular Weight: | 282.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Alpinia officinarum Hance |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H](CC(=O)CCc1ccccc1)CCc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (R)-5-Hydroxy-1,7-diphenyl-3-heptanone is a diarylheptanoid that can be found in Alpinia officinarum. (R)-5-Hydroxy-1,7-diphenyl-3-heptanone ameliorates oxidative stress and insulin resistance via activation of Nrf2/ARE pathway[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 473.8±33.0 °C at 760 mmHg |
| Flash Point | 201.4±18.0 °C |
| Exact Mass | 282.161987 |
| LogP | 3.55 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20°C |