Home
Products
Deacetyl ganoderic acid F
| Product Name | Deacetyl ganoderic acid F |
| Price: | $409 / 5mg |
| Catalog No.: | CN07549 |
| CAS No.: | 100665-44-9 |
| Molecular Formula: | C30H40O8 |
| Molecular Weight: | 528.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)CC(C1CC(=O)C2(C1(C)C(O)C(=O)C1=C2C(=O)CC2C1(C)CCC(=O)C2(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deacetyl Ganoderic Acid F is a 7-anostane triterpenoid from Ganoderma lucidum. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 707.9±60.0 °C at 760 mmHg |
| Flash Point | 395.9±29.4 °C |
| Exact Mass | 528.272339 |
| PSA | 142.88000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±5.1 mmHg at 25°C |