Home
Products
Ganoderenic acid C
| Product Name | Ganoderenic acid C |
| Price: | $584 / 5mg |
| Catalog No.: | CN07690 |
| CAS No.: | 100665-42-7 |
| Molecular Formula: | C30H44O7 |
| Molecular Weight: | 516.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruiting bodys of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)/C=C(/C1C[C@@H](C2(C1(C)CC(=O)C1=C2[C@@H](O)CC2C1(C)CC[C@@H](C2(C)C)O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderenic acid C is a triterpenoid isolated from Ganoderma lingzhi. Ganoderenic acid C is abundant in fruit bodies at an early growth stage[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 700.8±60.0 °C at 760 mmHg |
| Flash Point | 391.6±29.4 °C |
| Exact Mass | 516.308716 |
| PSA | 132.13000 |
| LogP | 2.04 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |