Home
Products
Ganoderenic acid B
| Product Name | Ganoderenic acid B |
| Price: | Inquiry |
| Catalog No.: | CN07350 |
| CAS No.: | 100665-41-6 |
| Molecular Formula: | C30H42O7 |
| Molecular Weight: | 514.65 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)C=C(C1CC(=O)C2(C1(C)CC(=O)C1=C2C(O)CC2C1(C)CCC(C2(C)C)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderenic acid B is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid B exhibits potent reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to Doxorubicin[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 702.7±60.0 °C at 760 mmHg |
| Flash Point | 392.8±29.4 °C |
| Exact Mass | 514.293030 |
| PSA | 128.97000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |