Home
Products
Ganoderenic acid A
| Product Name | Ganoderenic acid A |
| Price: | $176 / 5mg |
| Catalog No.: | CN07692 |
| CAS No.: | 100665-40-5 |
| Molecular Formula: | C30H42O7 |
| Molecular Weight: | 514.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruiting bodys of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)/C=C(C1C[C@@H](C2(C1(C)CC(=O)C1=C2[C@@H](O)CC2C1(C)CCC(=O)C2(C)C)C)O)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderenic acid A is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid A is a potent inhibitor of β-glucuronidase. Ganoderenic acid A has a potent hepatoprotective effect against CCl4-induced liver injury[1]. |
| Density | 1.24g/cm3 |
| Boiling Point | 700.3ºC at 760mmHg |
| Flash Point | 391.3ºC |
| Exact Mass | 514.29300 |
| PSA | 128.97000 |
| LogP | 4.05160 |
| Vapour Pressure | 1.12E-22mmHg at 25°C |