Home
Products
Sterigmatocystin
| Product Name | Sterigmatocystin |
| Price: | Inquiry |
| Catalog No.: | CN05766 |
| CAS No.: | 10048-13-2 |
| Molecular Formula: | C18H12O6 |
| Molecular Weight: | 324.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | From grains. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@@H]3[C@H](c2c2c1c(=O)c1c(o2)cccc1O)C=CO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sterigmatocystine, a precursor of aflatoxins and a mycotoxin produced by common mold strains from Aspergillus versicolor, has developmental, teratogenic, and carcinogenic effects in animals[1][2][3]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 569.7±50.0 °C at 760 mmHg |
| Flash Point | 215.9±23.6 °C |
| Exact Mass | 324.063385 |
| PSA | 78.13000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |