Home
Products
Rosiridin
| Product Name | Rosiridin |
| Price: | $409 / 10mg |
| Catalog No.: | CN09690 |
| CAS No.: | 100462-37-1 |
| Molecular Formula: | C16H28O7 |
| Molecular Weight: | 332.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The herb of Rhodiola rosea L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC=C(C(CC=C(C)C)O)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rosiridin, which is isolated from Rhodiola rosea L., inhibits MAO A and MAO B with potential beneficial effect in depression and senile dementia. Rosiridin shows an inhibition of 83.8% against MAO B at 10 μM (pIC50=5.38)[1]. |
| Target | pIC50: 5.38 (MAO B)[1] |
| In Vitro | Rosiridin presents an inhibition 16.2±2.3 and 83.8±1.1% on MAO A and MAO B at a concentration of 10 μM[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 563.5±50.0 °C at 760 mmHg |
| Flash Point | 294.6±30.1 °C |
| Exact Mass | 332.183502 |
| PSA | 119.61000 |
| LogP | -0.11 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Storage condition | 2-8℃ |