Home
Products
Ganoderic acid J
| Product Name | Ganoderic acid J |
| Price: | Inquiry |
| Catalog No.: | CN07108 |
| CAS No.: | 100440-26-4 |
| Molecular Formula: | C30H42O7 |
| Molecular Weight: | 514.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)C)CC(C1CC(C2(C1(C)CC(=O)C1=C2C(=O)CC2C1(C)CCC(=O)C2(C)C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid J is a natural terpenoid isolated from the Fungus Ganoderma lucidum. Ganoderic acid J possesses anti-inflammatory anti-inflammatory activity[1][2]. |