Home
Products
Dihydroresveratrol 3-O-glucoside
| Product Name | Dihydroresveratrol 3-O-glucoside |
| Price: | Inquiry |
| Catalog No.: | CN04152 |
| CAS No.: | 100432-87-9 |
| Molecular Formula: | C20H24O8 |
| Molecular Weight: | 392.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Polygonum cuspidatum Sieb. et Zucc. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(CCc3ccc(cc3)O)cc(c2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 681.3±55.0 °C at 760 mmHg |
| Flash Point | 365.8±31.5 °C |
| Exact Mass | 392.147125 |
| PSA | 139.84000 |
| LogP | 0.52 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |