Home
Products
2,3-dihydroxy-3-(4-hydroxyphenyl)propanoic acid
| Product Name | 2,3-dihydroxy-3-(4-hydroxyphenyl)propanoic acid |
| Price: | Inquiry |
| Catalog No.: | CN07055 |
| CAS No.: | 100201-57-8 |
| Molecular Formula: | C9H10O5 |
| Molecular Weight: | 198.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The barks of Taxus chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C(C(c1ccc(cc1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Hydroxy-3-(4-hydroxyphenyl)-lactic acid is a key metabolite in the P. roqueforti fermentation approach, with quantitative data of 10.2 ± 1.1 µM in Tyr1 (presence of L-tyrosine) of [1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 489.8±45.0 °C at 760 mmHg |
| Flash Point | 264.1±25.2 °C |
| Exact Mass | 198.052826 |
| PSA | 97.99000 |
| LogP | -0.74 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |